C10H13ClN2O3 — CID 123589448
4-[4-(chloromethyl)-1,3-oxazol-2-yl]piperidine-1-carboxylic acid (PubChem CID 123589448) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is 4-[4-(chloromethyl)-1,3-oxazol-2-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-(chloromethyl)-1,3-oxazol-2-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123589448 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-[4-(chloromethyl)-1,3-oxazol-2-yl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2nc(CCl)co2)CC1 |
| InChI | InChI=1S/C10H13ClN2O3/c11-5-8-6-16-9(12-8)7-1-3-13(4-2-7)10(14)15/h6-7H,1-5H2,(H,14,15) |
| InChIKey | CAPDAZNVOXYWRR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|