C19H28N2O3 — CID 123453208
2-propan-2-ylidenepent-3-enyl 4-(4-ethyl-1,3-oxazol-2-yl)piperidine-1-carboxylate (PubChem CID 123453208) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-propan-2-ylidenepent-3-enyl 4-(4-ethyl-1,3-oxazol-2-yl)piperidine-1-carboxylate.
| Compound Name | 2-propan-2-ylidenepent-3-enyl 4-(4-ethyl-1,3-oxazol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123453208 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-propan-2-ylidenepent-3-enyl 4-(4-ethyl-1,3-oxazol-2-yl)piperidine-1-carboxylate |
| SMILES | CC=CC(COC(=O)N1CCC(c2nc(CC)co2)CC1)=C(C)C |
| InChI | InChI=1S/C19H28N2O3/c1-5-7-16(14(3)4)12-24-19(22)21-10-8-15(9-11-21)18-20-17(6-2)13-23-18/h5,7,13,15H,6,8-12H2,1-4H3 |
| InChIKey | BCIWZISQXZRSKF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|