C9H14N2O3S — CID 115094200
5-[(1,1-dioxothian-3-yl)methyl]-1,2-oxazol-3-amine (PubChem CID 115094200) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-[(1,1-dioxothian-3-yl)methyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[(1,1-dioxothian-3-yl)methyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 115094200 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5-[(1,1-dioxothian-3-yl)methyl]-1,2-oxazol-3-amine |
| SMILES | Nc1cc(CC2CCCS(=O)(=O)C2)on1 |
| InChI | InChI=1S/C9H14N2O3S/c10-9-5-8(14-11-9)4-7-2-1-3-15(12,13)6-7/h5,7H,1-4,6H2,(H2,10,11) |
| InChIKey | UTGXMDLZBNASQD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |