C13H16N2O3S — CID 117144291
3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol (PubChem CID 117144291) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol.
| Compound Name | 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol |
|---|---|
| PubChem CID | 117144291 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol |
| SMILES | O=S1(=O)CCCC(Cc2ncc3cc(O)ccn23)C1 |
| InChI | InChI=1S/C13H16N2O3S/c16-12-3-4-15-11(7-12)8-14-13(15)6-10-2-1-5-19(17,18)9-10/h3-4,7-8,10,16H,1-2,5-6,9H2 |
| InChIKey | QETQGMARBFVQRB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |