About 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol
3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol (PubChem CID 117144291) has the molecular formula C13H16N2O3S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol.
Molecular Properties
| Compound Name | 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol |
| PubChem CID | 117144291 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol |
| SMILES | O=S1(=O)CCCC(Cc2ncc3cc(O)ccn23)C1 |
| InChI | InChI=1S/C13H16N2O3S/c16-12-3-4-15-11(7-12)8-14-13(15)6-10-2-1-5-19(17,18)9-10/h3-4,7-8,10,16H,1-2,5-6,9H2 |
| InChIKey | QETQGMARBFVQRB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol?
The IUPAC name of 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol (CID 117144291) is 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol.
What is the SMILES notation for 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol?
The canonical SMILES for 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol is O=S1(=O)CCCC(Cc2ncc3cc(O)ccn23)C1.
What is the InChIKey of 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol?
The InChIKey is QETQGMARBFVQRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3S/c16-12-3-4-15-11(7-12)8-14-13(15)6-10-2-1-5-19(17,18)9-10/h3-4,7-8,10,16H,1-2,5-6,9H2.
What are the key properties of 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol?
3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol has a molecular weight of 280.35 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothian-3-yl)methyl]imidazo[1,5-a]pyridin-7-ol is sourced from PubChem (CID 117144291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).