C13H14N2O3S — CID 117145951
3-[(1,1-dioxothiolan-3-yl)methyl]imidazo[1,5-a]pyridine-8-carbaldehyde (PubChem CID 117145951) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methyl]imidazo[1,5-a]pyridine-8-carbaldehyde.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methyl]imidazo[1,5-a]pyridine-8-carbaldehyde |
|---|---|
| PubChem CID | 117145951 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methyl]imidazo[1,5-a]pyridine-8-carbaldehyde |
| SMILES | O=Cc1cccn2c(CC3CCS(=O)(=O)C3)ncc12 |
| InChI | InChI=1S/C13H14N2O3S/c16-8-11-2-1-4-15-12(11)7-14-13(15)6-10-3-5-19(17,18)9-10/h1-2,4,7-8,10H,3,5-6,9H2 |
| InChIKey | KYHNBQKTWIBPOC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 68.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|