C12H15N3O2S — CID 117146321
3-[(1,1-dioxothiolan-3-yl)methyl]imidazo[1,5-a]pyridin-8-amine (PubChem CID 117146321) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methyl]imidazo[1,5-a]pyridin-8-amine.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methyl]imidazo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 117146321 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methyl]imidazo[1,5-a]pyridin-8-amine |
| SMILES | Nc1cccn2c(CC3CCS(=O)(=O)C3)ncc12 |
| InChI | InChI=1S/C12H15N3O2S/c13-10-2-1-4-15-11(10)7-14-12(15)6-9-3-5-18(16,17)8-9/h1-2,4,7,9H,3,5-6,8,13H2 |
| InChIKey | RPPUTQKSFKISLZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |