C13H15N3O — CID 117145941
3-piperidin-4-ylimidazo[1,5-a]pyridine-8-carbaldehyde (PubChem CID 117145941) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-piperidin-4-ylimidazo[1,5-a]pyridine-8-carbaldehyde.
| Compound Name | 3-piperidin-4-ylimidazo[1,5-a]pyridine-8-carbaldehyde |
|---|---|
| PubChem CID | 117145941 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-piperidin-4-ylimidazo[1,5-a]pyridine-8-carbaldehyde |
| SMILES | O=Cc1cccn2c(C3CCNCC3)ncc12 |
| InChI | InChI=1S/C13H15N3O/c17-9-11-2-1-7-16-12(11)8-15-13(16)10-3-5-14-6-4-10/h1-2,7-10,14H,3-6H2 |
| InChIKey | QIBJQKXVPBWZPT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|