C12H14FN3 — CID 105474056
8-fluoro-3-piperidin-4-ylimidazo[1,5-a]pyridine (PubChem CID 105474056) has the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. Its IUPAC name is 8-fluoro-3-piperidin-4-ylimidazo[1,5-a]pyridine.
| Compound Name | 8-fluoro-3-piperidin-4-ylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 105474056 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 8-fluoro-3-piperidin-4-ylimidazo[1,5-a]pyridine |
| SMILES | Fc1cccn2c(C3CCNCC3)ncc12 |
| InChI | InChI=1S/C12H14FN3/c13-10-2-1-7-16-11(10)8-15-12(16)9-3-5-14-6-4-9/h1-2,7-9,14H,3-6H2 |
| InChIKey | VVOWHHXJYGMYIZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |