C11H14N4 — CID 96619296
4-piperidin-4-yltriazolo[1,5-a]pyridine (PubChem CID 96619296) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 4-piperidin-4-yltriazolo[1,5-a]pyridine.
| Compound Name | 4-piperidin-4-yltriazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 96619296 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 4-piperidin-4-yltriazolo[1,5-a]pyridine |
| SMILES | c1cc(C2CCNCC2)c2cnnn2c1 |
| InChI | InChI=1S/C11H14N4/c1-2-10(9-3-5-12-6-4-9)11-8-13-14-15(11)7-1/h1-2,7-9,12H,3-6H2 |
| InChIKey | ZQTOTVXNIKXFMM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |