C11H12FN3O — CID 105477187
2-(8-fluoroimidazo[1,5-a]pyridin-3-yl)morpholine (PubChem CID 105477187) has the molecular formula C11H12FN3O and a molecular weight of 221.23 g/mol. Its IUPAC name is 2-(8-fluoroimidazo[1,5-a]pyridin-3-yl)morpholine.
| Compound Name | 2-(8-fluoroimidazo[1,5-a]pyridin-3-yl)morpholine |
|---|---|
| PubChem CID | 105477187 |
| Molecular Formula | C11H12FN3O |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-(8-fluoroimidazo[1,5-a]pyridin-3-yl)morpholine |
| SMILES | Fc1cccn2c(C3CNCCO3)ncc12 |
| InChI | InChI=1S/C11H12FN3O/c12-8-2-1-4-15-9(8)6-14-11(15)10-7-13-3-5-16-10/h1-2,4,6,10,13H,3,5,7H2 |
| InChIKey | OQJMHEPLPZEFNF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |