C12H14N2O2 — CID 117145426
8-methoxy-3-(oxolan-2-yl)imidazo[1,5-a]pyridine (PubChem CID 117145426) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 8-methoxy-3-(oxolan-2-yl)imidazo[1,5-a]pyridine.
| Compound Name | 8-methoxy-3-(oxolan-2-yl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117145426 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 8-methoxy-3-(oxolan-2-yl)imidazo[1,5-a]pyridine |
| SMILES | COc1cccn2c(C3CCCO3)ncc12 |
| InChI | InChI=1S/C12H14N2O2/c1-15-10-4-2-6-14-9(10)8-13-12(14)11-5-3-7-16-11/h2,4,6,8,11H,3,5,7H2,1H3 |
| InChIKey | DQPAUNKOXNAEIS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |