C15H14N2O — CID 117145591
8-methoxy-3-(2-methylphenyl)imidazo[1,5-a]pyridine (PubChem CID 117145591) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 8-methoxy-3-(2-methylphenyl)imidazo[1,5-a]pyridine.
| Compound Name | 8-methoxy-3-(2-methylphenyl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117145591 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 8-methoxy-3-(2-methylphenyl)imidazo[1,5-a]pyridine |
| SMILES | COc1cccn2c(-c3ccccc3C)ncc12 |
| InChI | InChI=1S/C15H14N2O/c1-11-6-3-4-7-12(11)15-16-10-13-14(18-2)8-5-9-17(13)15/h3-10H,1-2H3 |
| InChIKey | GWGWBIIQAFUWMT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |