C14H15NO — CID 155353771
4-(2-methoxyphenyl)-2,5-dimethylpyridine (PubChem CID 155353771) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-2,5-dimethylpyridine.
| Compound Name | 4-(2-methoxyphenyl)-2,5-dimethylpyridine |
|---|---|
| PubChem CID | 155353771 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 4-(2-methoxyphenyl)-2,5-dimethylpyridine |
| SMILES | COc1ccccc1-c1cc(C)ncc1C |
| InChI | InChI=1S/C14H15NO/c1-10-9-15-11(2)8-13(10)12-6-4-5-7-14(12)16-3/h4-9H,1-3H3 |
| InChIKey | ZSTAOJRQOZVASI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |