C12H17FN2O — CID 115111854
2-fluoro-N,N-dimethyl-6-morpholin-2-ylaniline (PubChem CID 115111854) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-6-morpholin-2-ylaniline.
| Compound Name | 2-fluoro-N,N-dimethyl-6-morpholin-2-ylaniline |
|---|---|
| PubChem CID | 115111854 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-6-morpholin-2-ylaniline |
| SMILES | CN(C)c1c(F)cccc1C1CNCCO1 |
| InChI | InChI=1S/C12H17FN2O/c1-15(2)12-9(4-3-5-10(12)13)11-8-14-6-7-16-11/h3-5,11,14H,6-8H2,1-2H3 |
| InChIKey | CLAUIOPZNDVFFX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |