C12H17NOS2 — CID 117391940
2-[2,3-bis(methylsulfanyl)phenyl]morpholine (PubChem CID 117391940) has the molecular formula C12H17NOS2 and a molecular weight of 255.41 g/mol. Its IUPAC name is 2-[2,3-bis(methylsulfanyl)phenyl]morpholine.
| Compound Name | 2-[2,3-bis(methylsulfanyl)phenyl]morpholine |
|---|---|
| PubChem CID | 117391940 |
| Molecular Formula | C12H17NOS2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-[2,3-bis(methylsulfanyl)phenyl]morpholine |
| SMILES | CSc1cccc(C2CNCCO2)c1SC |
| InChI | InChI=1S/C12H17NOS2/c1-15-11-5-3-4-9(12(11)16-2)10-8-13-6-7-14-10/h3-5,10,13H,6-8H2,1-2H3 |
| InChIKey | WRPTXJZAUIZNHS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |