C13H18FNO3S — CID 117463646
2-(5-fluoro-2,3-dimethoxy-4-methylsulfanylphenyl)morpholine (PubChem CID 117463646) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-(5-fluoro-2,3-dimethoxy-4-methylsulfanylphenyl)morpholine.
| Compound Name | 2-(5-fluoro-2,3-dimethoxy-4-methylsulfanylphenyl)morpholine |
|---|---|
| PubChem CID | 117463646 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-(5-fluoro-2,3-dimethoxy-4-methylsulfanylphenyl)morpholine |
| SMILES | COc1c(C2CNCCO2)cc(F)c(SC)c1OC |
| InChI | InChI=1S/C13H18FNO3S/c1-16-11-8(10-7-15-4-5-18-10)6-9(14)13(19-3)12(11)17-2/h6,10,15H,4-5,7H2,1-3H3 |
| InChIKey | BIASSTHEZFWTMB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |