C13H16F3NO3 — CID 117470350
2-[2,5-dimethoxy-3-(trifluoromethyl)phenyl]morpholine (PubChem CID 117470350) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-[2,5-dimethoxy-3-(trifluoromethyl)phenyl]morpholine.
| Compound Name | 2-[2,5-dimethoxy-3-(trifluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 117470350 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[2,5-dimethoxy-3-(trifluoromethyl)phenyl]morpholine |
| SMILES | COc1cc(C2CNCCO2)c(OC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO3/c1-18-8-5-9(11-7-17-3-4-20-11)12(19-2)10(6-8)13(14,15)16/h5-6,11,17H,3-4,7H2,1-2H3 |
| InChIKey | WSWTUMVUOONMTH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |