C10H11FN4O — CID 105478866
2-(7-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)morpholine (PubChem CID 105478866) has the molecular formula C10H11FN4O and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-(7-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)morpholine.
| Compound Name | 2-(7-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)morpholine |
|---|---|
| PubChem CID | 105478866 |
| Molecular Formula | C10H11FN4O |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-(7-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)morpholine |
| SMILES | Fc1ccn2c(C3CNCCO3)nnc2c1 |
| InChI | InChI=1S/C10H11FN4O/c11-7-1-3-15-9(5-7)13-14-10(15)8-6-12-2-4-16-8/h1,3,5,8,12H,2,4,6H2 |
| InChIKey | XQUNVPJWMCTIRD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |