C10H13NO3S — CID 115083332
2-(thian-2-ylmethyl)-1,3-oxazole-4-carboxylic acid (PubChem CID 115083332) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-(thian-2-ylmethyl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(thian-2-ylmethyl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115083332 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-(thian-2-ylmethyl)-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(CC2CCCCS2)n1 |
| InChI | InChI=1S/C10H13NO3S/c12-10(13)8-6-14-9(11-8)5-7-3-1-2-4-15-7/h6-7H,1-5H2,(H,12,13) |
| InChIKey | JBVVFZPHPIFDFA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |