C10H15NO2S — CID 115083037
1-[2-(thiolan-2-ylmethyl)-1,3-oxazol-4-yl]ethanol (PubChem CID 115083037) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 1-[2-(thiolan-2-ylmethyl)-1,3-oxazol-4-yl]ethanol.
| Compound Name | 1-[2-(thiolan-2-ylmethyl)-1,3-oxazol-4-yl]ethanol |
|---|---|
| PubChem CID | 115083037 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-[2-(thiolan-2-ylmethyl)-1,3-oxazol-4-yl]ethanol |
| SMILES | CC(O)c1coc(CC2CCCS2)n1 |
| InChI | InChI=1S/C10H15NO2S/c1-7(12)9-6-13-10(11-9)5-8-3-2-4-14-8/h6-8,12H,2-5H2,1H3 |
| InChIKey | YPNZZQXOSPLOGW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |