About 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol
2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol (PubChem CID 115083874) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol.
Molecular Properties
| Compound Name | 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol |
| PubChem CID | 115083874 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol |
| SMILES | CC(O)c1coc(Cc2ccccc2O)n1 |
| InChI | InChI=1S/C12H13NO3/c1-8(14)10-7-16-12(13-10)6-9-4-2-3-5-11(9)15/h2-5,7-8,14-15H,6H2,1H3 |
| InChIKey | MCTFYCNLZBQYMN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol?
The IUPAC name of 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol (CID 115083874) is 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol.
What is the SMILES notation for 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol?
The canonical SMILES for 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol is CC(O)c1coc(Cc2ccccc2O)n1.
What is the InChIKey of 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol?
The InChIKey is MCTFYCNLZBQYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-8(14)10-7-16-12(13-10)6-9-4-2-3-5-11(9)15/h2-5,7-8,14-15H,6H2,1H3.
What are the key properties of 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol?
2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol has a molecular weight of 219.24 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol is sourced from PubChem (CID 115083874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).