C13H14ClNO2 — CID 115083926
2-[2-[(2-chlorophenyl)methyl]-1,3-oxazol-4-yl]propan-1-ol (PubChem CID 115083926) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 2-[2-[(2-chlorophenyl)methyl]-1,3-oxazol-4-yl]propan-1-ol.
| Compound Name | 2-[2-[(2-chlorophenyl)methyl]-1,3-oxazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 115083926 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-[2-[(2-chlorophenyl)methyl]-1,3-oxazol-4-yl]propan-1-ol |
| SMILES | CC(CO)c1coc(Cc2ccccc2Cl)n1 |
| InChI | InChI=1S/C13H14ClNO2/c1-9(7-16)12-8-17-13(15-12)6-10-4-2-3-5-11(10)14/h2-5,8-9,16H,6-7H2,1H3 |
| InChIKey | GRSZOSNWENNEDR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |