C12H13NO3 — CID 115086774
2-[[5-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol (PubChem CID 115086774) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[[5-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol.
| Compound Name | 2-[[5-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 115086774 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-[[5-(1-hydroxyethyl)-1,3-oxazol-2-yl]methyl]phenol |
| SMILES | CC(O)c1cnc(Cc2ccccc2O)o1 |
| InChI | InChI=1S/C12H13NO3/c1-8(14)11-7-13-12(16-11)6-9-4-2-3-5-10(9)15/h2-5,7-8,14-15H,6H2,1H3 |
| InChIKey | UKKTWRKWYAJSTR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |