C14H17NO3 — CID 115086826
2-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-5-yl]propan-1-ol (PubChem CID 115086826) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-5-yl]propan-1-ol.
| Compound Name | 2-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 115086826 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-5-yl]propan-1-ol |
| SMILES | COc1ccccc1Cc1ncc(C(C)CO)o1 |
| InChI | InChI=1S/C14H17NO3/c1-10(9-16)13-8-15-14(18-13)7-11-5-3-4-6-12(11)17-2/h3-6,8,10,16H,7,9H2,1-2H3 |
| InChIKey | CYDBPSARMZYAIW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |