C14H17NO2S — CID 115089285
2-[2-[(2-methoxyphenyl)methyl]-1,3-thiazol-4-yl]propan-1-ol (PubChem CID 115089285) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-[2-[(2-methoxyphenyl)methyl]-1,3-thiazol-4-yl]propan-1-ol.
| Compound Name | 2-[2-[(2-methoxyphenyl)methyl]-1,3-thiazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 115089285 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[2-[(2-methoxyphenyl)methyl]-1,3-thiazol-4-yl]propan-1-ol |
| SMILES | COc1ccccc1Cc1nc(C(C)CO)cs1 |
| InChI | InChI=1S/C14H17NO2S/c1-10(8-16)12-9-18-14(15-12)7-11-5-3-4-6-13(11)17-2/h3-6,9-10,16H,7-8H2,1-2H3 |
| InChIKey | UTHVDYBMVHWUMY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |