C12H11NO3 — CID 115086783
1-[2-[(2-hydroxyphenyl)methyl]-1,3-oxazol-5-yl]ethanone (PubChem CID 115086783) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-[2-[(2-hydroxyphenyl)methyl]-1,3-oxazol-5-yl]ethanone.
| Compound Name | 1-[2-[(2-hydroxyphenyl)methyl]-1,3-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 115086783 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1-[2-[(2-hydroxyphenyl)methyl]-1,3-oxazol-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(Cc2ccccc2O)o1 |
| InChI | InChI=1S/C12H11NO3/c1-8(14)11-7-13-12(16-11)6-9-4-2-3-5-10(9)15/h2-5,7,15H,6H2,1H3 |
| InChIKey | MCGDXWHDTSYTHS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |