C9H14N2O2 — CID 83876068
1-[2-(diethylamino)-1,3-oxazol-5-yl]ethanone (PubChem CID 83876068) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-[2-(diethylamino)-1,3-oxazol-5-yl]ethanone.
| Compound Name | 1-[2-(diethylamino)-1,3-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 83876068 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-[2-(diethylamino)-1,3-oxazol-5-yl]ethanone |
| SMILES | CCN(CC)c1ncc(C(C)=O)o1 |
| InChI | InChI=1S/C9H14N2O2/c1-4-11(5-2)9-10-6-8(13-9)7(3)12/h6H,4-5H2,1-3H3 |
| InChIKey | OEVMUGLGBYBWRN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |