C12H10BrNO2 — CID 115086653
1-[2-[(3-bromophenyl)methyl]-1,3-oxazol-5-yl]ethanone (PubChem CID 115086653) has the molecular formula C12H10BrNO2 and a molecular weight of 280.12 g/mol. Its IUPAC name is 1-[2-[(3-bromophenyl)methyl]-1,3-oxazol-5-yl]ethanone.
| Compound Name | 1-[2-[(3-bromophenyl)methyl]-1,3-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 115086653 |
| Molecular Formula | C12H10BrNO2 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 1-[2-[(3-bromophenyl)methyl]-1,3-oxazol-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(Cc2cccc(Br)c2)o1 |
| InChI | InChI=1S/C12H10BrNO2/c1-8(15)11-7-14-12(16-11)6-9-3-2-4-10(13)5-9/h2-5,7H,6H2,1H3 |
| InChIKey | KRUYGWWGDUCKFX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |