C11H16N2O3S — CID 115078455
3-[5-(thian-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid (PubChem CID 115078455) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-[5-(thian-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid.
| Compound Name | 3-[5-(thian-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 115078455 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-[5-(thian-2-ylmethyl)-1,2,4-oxadiazol-3-yl]propanoic acid |
| SMILES | O=C(O)CCc1noc(CC2CCCCS2)n1 |
| InChI | InChI=1S/C11H16N2O3S/c14-11(15)5-4-9-12-10(16-13-9)7-8-3-1-2-6-17-8/h8H,1-7H2,(H,14,15) |
| InChIKey | WKPUKFJQZGNLCS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |