C11H15NO3 — CID 115082311
1-[2-(oxolan-3-ylmethyl)-1,3-oxazol-4-yl]propan-2-one (PubChem CID 115082311) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-[2-(oxolan-3-ylmethyl)-1,3-oxazol-4-yl]propan-2-one.
| Compound Name | 1-[2-(oxolan-3-ylmethyl)-1,3-oxazol-4-yl]propan-2-one |
|---|---|
| PubChem CID | 115082311 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-[2-(oxolan-3-ylmethyl)-1,3-oxazol-4-yl]propan-2-one |
| SMILES | CC(=O)Cc1coc(CC2CCOC2)n1 |
| InChI | InChI=1S/C11H15NO3/c1-8(13)4-10-7-15-11(12-10)5-9-2-3-14-6-9/h7,9H,2-6H2,1H3 |
| InChIKey | BSCBCTHSCPQVHY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |