C19H21N4NiO3- — CID 178051576
2-(ethenylamino)-N-[2-methyl-5-[5-[[(3R)-oxolan-3-yl]methyl]-1,2,4-oxadiazol-3-yl]phenyl]prop-2-enamide;nickel (PubChem CID 178051576) has the molecular formula C19H21N4NiO3- and a molecular weight of 412.10 g/mol. Its IUPAC name is 2-(ethenylamino)-N-[2-methyl-5-[5-[[(3R)-oxolan-3-yl]methyl]-1,2,4-oxadiazol-3-yl]phenyl]prop-2-enamide;nickel.
| Compound Name | 2-(ethenylamino)-N-[2-methyl-5-[5-[[(3R)-oxolan-3-yl]methyl]-1,2,4-oxadiazol-3-yl]phenyl]prop-2-enamide;nickel |
|---|---|
| PubChem CID | 178051576 |
| Molecular Formula | C19H21N4NiO3- |
| Molecular Weight | 412.10 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-(ethenylamino)-N-[2-methyl-5-[5-[[(3R)-oxolan-3-yl]methyl]-1,2,4-oxadiazol-3-yl]phenyl]prop-2-enamide;nickel |
| SMILES | [H]/[C-]=C(/NC=C)C(=O)Nc1cc(-c2noc(C[C@H]3CCOC3)n2)ccc1C.[Ni] |
| InChI | InChI=1S/C19H21N4O3.Ni/c1-4-20-13(3)19(24)21-16-10-15(6-5-12(16)2)18-22-17(26-23-18)9-14-7-8-25-11-14;/h3-6,10,14,20H,1,7-9,11H2,2H3,(H,21,24);/q-1;/t14-;/m1./s1 |
| InChIKey | XJAVHQAYSNGUKE-PFEQFJNWSA-N |
| XLogP | 2.61 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.10 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|