C22H24N4O4 — CID 3164461
1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methylphenyl)-1-prop-2-enylurea (PubChem CID 3164461) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methylphenyl)-1-prop-2-enylurea.
| Compound Name | 1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methylphenyl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 3164461 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methylphenyl)-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1nc(-c2ccc(OC)c(OC)c2)no1)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C22H24N4O4/c1-5-12-26(22(27)23-17-9-7-6-8-15(17)2)14-20-24-21(25-30-20)16-10-11-18(28-3)19(13-16)29-4/h5-11,13H,1,12,14H2,2-4H3,(H,23,27) |
| InChIKey | MGDLZYBCNYJMCX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|