C20H19ClN4O3 — CID 3164426
1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methoxyphenyl)-1-prop-2-enylurea (PubChem CID 3164426) has the molecular formula C20H19ClN4O3 and a molecular weight of 398.85 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methoxyphenyl)-1-prop-2-enylurea.
| Compound Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methoxyphenyl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 3164426 |
| Molecular Formula | C20H19ClN4O3 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(2-methoxyphenyl)-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1nc(-c2ccc(Cl)cc2)no1)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C20H19ClN4O3/c1-3-12-25(20(26)22-16-6-4-5-7-17(16)27-2)13-18-23-19(24-28-18)14-8-10-15(21)11-9-14/h3-11H,1,12-13H2,2H3,(H,22,26) |
| InChIKey | WCNWNLNCCNZMAN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|