C22H22ClN3O3 — CID 8874885
N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(2,5-dimethylphenoxy)-N-prop-2-enylacetamide (PubChem CID 8874885) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(2,5-dimethylphenoxy)-N-prop-2-enylacetamide.
| Compound Name | N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(2,5-dimethylphenoxy)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 8874885 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(2,5-dimethylphenoxy)-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1nc(-c2ccc(Cl)cc2)no1)C(=O)COc1cc(C)ccc1C |
| InChI | InChI=1S/C22H22ClN3O3/c1-4-11-26(21(27)14-28-19-12-15(2)5-6-16(19)3)13-20-24-22(25-29-20)17-7-9-18(23)10-8-17/h4-10,12H,1,11,13-14H2,2-3H3 |
| InChIKey | KQDCIPCCGSWRMQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|