C21H20ClN3O3 — CID 8874467
3-chloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-methyl-N-prop-2-enylbenzamide (PubChem CID 8874467) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is 3-chloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-methyl-N-prop-2-enylbenzamide.
| Compound Name | 3-chloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-methyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 8874467 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 3-chloro-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-methyl-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1nc(-c2ccc(OC)cc2)no1)C(=O)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O3/c1-4-11-25(21(26)16-6-5-14(2)18(22)12-16)13-19-23-20(24-28-19)15-7-9-17(27-3)10-8-15/h4-10,12H,1,11,13H2,2-3H3 |
| InChIKey | YGBYKCLWKNHUIP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|