C19H19N3O4 — CID 6462227
N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-N-prop-2-enylfuran-3-carboxamide (PubChem CID 6462227) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-N-prop-2-enylfuran-3-carboxamide.
| Compound Name | N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-N-prop-2-enylfuran-3-carboxamide |
|---|---|
| PubChem CID | 6462227 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-N-prop-2-enylfuran-3-carboxamide |
| SMILES | C=CCN(Cc1nc(-c2ccc(OC)cc2)no1)C(=O)c1ccoc1C |
| InChI | InChI=1S/C19H19N3O4/c1-4-10-22(19(23)16-9-11-25-13(16)2)12-17-20-18(21-26-17)14-5-7-15(24-3)8-6-14/h4-9,11H,1,10,12H2,2-3H3 |
| InChIKey | DWRSWCJWRCOZHG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|