C20H18FN3O2 — CID 8835731
2-fluoro-N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylbenzamide (PubChem CID 8835731) has the molecular formula C20H18FN3O2 and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-fluoro-N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylbenzamide.
| Compound Name | 2-fluoro-N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 8835731 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-fluoro-N-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1nc(-c2ccc(C)cc2)no1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C20H18FN3O2/c1-3-12-24(20(25)16-6-4-5-7-17(16)21)13-18-22-19(23-26-18)15-10-8-14(2)9-11-15/h3-11H,1,12-13H2,2H3 |
| InChIKey | XDLOGEAODJAZID-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|