C21H21N3O2 — CID 8875297
2,4-dimethyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-prop-2-enylbenzamide (PubChem CID 8875297) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-prop-2-enylbenzamide.
| Compound Name | 2,4-dimethyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 8875297 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2,4-dimethyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1nc(-c2ccccc2)no1)C(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C21H21N3O2/c1-4-12-24(21(25)18-11-10-15(2)13-16(18)3)14-19-22-20(23-26-19)17-8-6-5-7-9-17/h4-11,13H,1,12,14H2,2-3H3 |
| InChIKey | GMDHCHONPUPLGL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|