C17H22N4O2 — CID 6462165
3-tert-butyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1-prop-2-enylurea (PubChem CID 6462165) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-tert-butyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1-prop-2-enylurea.
| Compound Name | 3-tert-butyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 6462165 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-tert-butyl-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1nc(-c2ccccc2)no1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H22N4O2/c1-5-11-21(16(22)19-17(2,3)4)12-14-18-15(20-23-14)13-9-7-6-8-10-13/h5-10H,1,11-12H2,2-4H3,(H,19,22) |
| InChIKey | VOQNGTRUYNNHKN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|