C21H22N4O2 — CID 17325317
3-(4-methylphenyl)-1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-prop-2-enylurea (PubChem CID 17325317) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-prop-2-enylurea.
| Compound Name | 3-(4-methylphenyl)-1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 17325317 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-(4-methylphenyl)-1-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(Cc1nc(-c2ccc(C)cc2)no1)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C21H22N4O2/c1-4-13-25(21(26)22-18-11-7-16(3)8-12-18)14-19-23-20(24-27-19)17-9-5-15(2)6-10-17/h4-12H,1,13-14H2,2-3H3,(H,22,26) |
| InChIKey | SMFHRFHYNACELM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|