C21H19Cl2N3O4 — CID 18524783
3,4-dichloro-N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylbenzamide (PubChem CID 18524783) has the molecular formula C21H19Cl2N3O4 and a molecular weight of 448.31 g/mol. Its IUPAC name is 3,4-dichloro-N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylbenzamide.
| Compound Name | 3,4-dichloro-N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 18524783 |
| Molecular Formula | C21H19Cl2N3O4 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 3,4-dichloro-N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1nc(-c2ccc(OC)c(OC)c2)no1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N3O4/c1-4-9-26(21(27)14-5-7-15(22)16(23)10-14)12-19-24-20(25-30-19)13-6-8-17(28-2)18(11-13)29-3/h4-8,10-11H,1,9,12H2,2-3H3 |
| InChIKey | YNMOJNVRXZJUCL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|