C23H25N3O4 — CID 8836373
N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-phenyl-N-prop-2-enylpropanamide (PubChem CID 8836373) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-phenyl-N-prop-2-enylpropanamide.
| Compound Name | N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-phenyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 8836373 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-phenyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(Cc1nc(-c2ccc(OC)c(OC)c2)no1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C23H25N3O4/c1-4-14-26(22(27)13-10-17-8-6-5-7-9-17)16-21-24-23(25-30-21)18-11-12-19(28-2)20(15-18)29-3/h4-9,11-12,15H,1,10,13-14,16H2,2-3H3 |
| InChIKey | YORGMULRYCUEJW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|