C21H27N3O3 — CID 8875322
3-cyclopentyl-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylpropanamide (PubChem CID 8875322) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-cyclopentyl-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylpropanamide.
| Compound Name | 3-cyclopentyl-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 8875322 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 3-cyclopentyl-N-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-prop-2-enylpropanamide |
| SMILES | C=CCN(Cc1nc(-c2ccc(OC)cc2)no1)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C21H27N3O3/c1-3-14-24(20(25)13-8-16-6-4-5-7-16)15-19-22-21(23-27-19)17-9-11-18(26-2)12-10-17/h3,9-12,16H,1,4-8,13-15H2,2H3 |
| InChIKey | SCQGPPISUBJBTD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|