C14H18N4O — CID 55049135
5-(2-piperidin-2-ylethyl)-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 55049135) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-(2-piperidin-2-ylethyl)-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-(2-piperidin-2-ylethyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55049135 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 5-(2-piperidin-2-ylethyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | c1cc(-c2noc(CCC3CCCCN3)n2)ccn1 |
| InChI | InChI=1S/C14H18N4O/c1-2-8-16-12(3-1)4-5-13-17-14(18-19-13)11-6-9-15-10-7-11/h6-7,9-10,12,16H,1-5,8H2 |
| InChIKey | SADNWTAPWAHLDW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |