C9H16N4O — CID 65419210
5-(2-piperidin-3-ylethyl)-1,2,4-oxadiazol-3-amine (PubChem CID 65419210) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-(2-piperidin-3-ylethyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(2-piperidin-3-ylethyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 65419210 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 5-(2-piperidin-3-ylethyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(CCC2CCCNC2)n1 |
| InChI | InChI=1S/C9H16N4O/c10-9-12-8(14-13-9)4-3-7-2-1-5-11-6-7/h7,11H,1-6H2,(H2,10,13) |
| InChIKey | WLXYUNPQLSPJSN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |