C9H16N4O2 — CID 65418361
5-(2-piperidin-4-yloxyethyl)-1,2,4-oxadiazol-3-amine (PubChem CID 65418361) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 5-(2-piperidin-4-yloxyethyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(2-piperidin-4-yloxyethyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 65418361 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 5-(2-piperidin-4-yloxyethyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(CCOC2CCNCC2)n1 |
| InChI | InChI=1S/C9H16N4O2/c10-9-12-8(15-13-9)3-6-14-7-1-4-11-5-2-7/h7,11H,1-6H2,(H2,10,13) |
| InChIKey | MPBYWJOUOPKQNX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |