C14H16Cl2N2O2 — CID 107676158
5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole (PubChem CID 107676158) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole.
| Compound Name | 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 107676158 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole |
| SMILES | Clc1cc(Cl)c2oc(CCOC3CCNCC3)nc2c1 |
| InChI | InChI=1S/C14H16Cl2N2O2/c15-9-7-11(16)14-12(8-9)18-13(20-14)3-6-19-10-1-4-17-5-2-10/h7-8,10,17H,1-6H2 |
| InChIKey | LBBIMOFFVZQKMP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |