About 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole
5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole (PubChem CID 107676158) has the molecular formula C14H16Cl2N2O2
and a molecular weight of 315.20 g/mol. Its IUPAC name is 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole |
| PubChem CID | 107676158 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole |
| SMILES | Clc1cc(Cl)c2oc(CCOC3CCNCC3)nc2c1 |
| InChI | InChI=1S/C14H16Cl2N2O2/c15-9-7-11(16)14-12(8-9)18-13(20-14)3-6-19-10-1-4-17-5-2-10/h7-8,10,17H,1-6H2 |
| InChIKey | LBBIMOFFVZQKMP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole?
The IUPAC name of 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole (CID 107676158) is 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole.
What is the SMILES notation for 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole?
The canonical SMILES for 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole is Clc1cc(Cl)c2oc(CCOC3CCNCC3)nc2c1.
What is the InChIKey of 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole?
The InChIKey is LBBIMOFFVZQKMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2N2O2/c15-9-7-11(16)14-12(8-9)18-13(20-14)3-6-19-10-1-4-17-5-2-10/h7-8,10,17H,1-6H2.
What are the key properties of 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole?
5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole has a molecular weight of 315.20 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-2-(2-piperidin-4-yloxyethyl)-1,3-benzoxazole is sourced from PubChem (CID 107676158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).