C14H17Cl3N2O2 — CID 63875787
3-piperidin-4-yloxy-N-(2,4,6-trichlorophenyl)propanamide (PubChem CID 63875787) has the molecular formula C14H17Cl3N2O2 and a molecular weight of 351.66 g/mol. Its IUPAC name is 3-piperidin-4-yloxy-N-(2,4,6-trichlorophenyl)propanamide.
| Compound Name | 3-piperidin-4-yloxy-N-(2,4,6-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 63875787 |
| Molecular Formula | C14H17Cl3N2O2 |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 3-piperidin-4-yloxy-N-(2,4,6-trichlorophenyl)propanamide |
| SMILES | O=C(CCOC1CCNCC1)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl3N2O2/c15-9-7-11(16)14(12(17)8-9)19-13(20)3-6-21-10-1-4-18-5-2-10/h7-8,10,18H,1-6H2,(H,19,20) |
| InChIKey | YURMNFPHDZQSTL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |