C15H19ClFNO2 — CID 103052354
1-(5-chloro-2-fluorophenyl)-4-piperidin-4-yloxybutan-2-one (PubChem CID 103052354) has the molecular formula C15H19ClFNO2 and a molecular weight of 299.77 g/mol. Its IUPAC name is 1-(5-chloro-2-fluorophenyl)-4-piperidin-4-yloxybutan-2-one.
| Compound Name | 1-(5-chloro-2-fluorophenyl)-4-piperidin-4-yloxybutan-2-one |
|---|---|
| PubChem CID | 103052354 |
| Molecular Formula | C15H19ClFNO2 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-(5-chloro-2-fluorophenyl)-4-piperidin-4-yloxybutan-2-one |
| SMILES | O=C(CCOC1CCNCC1)Cc1cc(Cl)ccc1F |
| InChI | InChI=1S/C15H19ClFNO2/c16-12-1-2-15(17)11(9-12)10-13(19)5-8-20-14-3-6-18-7-4-14/h1-2,9,14,18H,3-8,10H2 |
| InChIKey | POTIQAFOEISDBD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |