C14H17Cl2FN2O2 — CID 83077626
N-(2,6-dichloro-4-fluorophenyl)-3-piperidin-4-yloxypropanamide (PubChem CID 83077626) has the molecular formula C14H17Cl2FN2O2 and a molecular weight of 335.21 g/mol. Its IUPAC name is N-(2,6-dichloro-4-fluorophenyl)-3-piperidin-4-yloxypropanamide.
| Compound Name | N-(2,6-dichloro-4-fluorophenyl)-3-piperidin-4-yloxypropanamide |
|---|---|
| PubChem CID | 83077626 |
| Molecular Formula | C14H17Cl2FN2O2 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-(2,6-dichloro-4-fluorophenyl)-3-piperidin-4-yloxypropanamide |
| SMILES | O=C(CCOC1CCNCC1)Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C14H17Cl2FN2O2/c15-11-7-9(17)8-12(16)14(11)19-13(20)3-6-21-10-1-4-18-5-2-10/h7-8,10,18H,1-6H2,(H,19,20) |
| InChIKey | GFIYEPSUHZOXKN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |